C16H21F3N4O4S — CID 25126578
N',N'-dimethyl-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetohydrazide (PubChem CID 25126578) has the molecular formula C16H21F3N4O4S and a molecular weight of 422.43 g/mol. Its IUPAC name is N',N'-dimethyl-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetohydrazide.
| Compound Name | N',N'-dimethyl-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetohydrazide |
|---|---|
| PubChem CID | 25126578 |
| Molecular Formula | C16H21F3N4O4S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N',N'-dimethyl-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetohydrazide |
| SMILES | CN(C)NC(=O)CON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H21F3N4O4S/c1-22(2)20-15(24)11-27-21-13-6-8-23(9-7-13)28(25,26)14-5-3-4-12(10-14)16(17,18)19/h3-5,10H,6-9,11H2,1-2H3,(H,20,24) |
| InChIKey | JWNDQPQWQTUBQZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|