C17H16F3N3O4S2 — CID 58378580
[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] 2-(1,3-thiazol-2-yl)acetate (PubChem CID 58378580) has the molecular formula C17H16F3N3O4S2 and a molecular weight of 447.46 g/mol. Its IUPAC name is [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] 2-(1,3-thiazol-2-yl)acetate.
| Compound Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] 2-(1,3-thiazol-2-yl)acetate |
|---|---|
| PubChem CID | 58378580 |
| Molecular Formula | C17H16F3N3O4S2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] 2-(1,3-thiazol-2-yl)acetate |
| SMILES | O=C(Cc1nccs1)ON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H16F3N3O4S2/c18-17(19,20)12-2-1-3-14(10-12)29(25,26)23-7-4-13(5-8-23)22-27-16(24)11-15-21-6-9-28-15/h1-3,6,9-10H,4-5,7-8,11H2 |
| InChIKey | RAWHCOGONBGWCE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|