C22H19F3N4O4S — CID 87367477
[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-isoquinolin-3-ylcarbamate (PubChem CID 87367477) has the molecular formula C22H19F3N4O4S and a molecular weight of 492.48 g/mol. Its IUPAC name is [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-isoquinolin-3-ylcarbamate.
| Compound Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 87367477 |
| Molecular Formula | C22H19F3N4O4S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-isoquinolin-3-ylcarbamate |
| SMILES | O=C(Nc1cc2ccccc2cn1)ON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H19F3N4O4S/c23-22(24,25)17-6-3-7-19(13-17)34(31,32)29-10-8-18(9-11-29)28-33-21(30)27-20-12-15-4-1-2-5-16(15)14-26-20/h1-7,12-14H,8-11H2,(H,26,27,30) |
| InChIKey | MUFFJXLRPKMXFO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|