C19H17F4N3O4S — CID 87366938
[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-(3-fluorophenyl)carbamate (PubChem CID 87366938) has the molecular formula C19H17F4N3O4S and a molecular weight of 459.42 g/mol. Its IUPAC name is [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-(3-fluorophenyl)carbamate.
| Compound Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 87366938 |
| Molecular Formula | C19H17F4N3O4S |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-(3-fluorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(F)c1)ON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H17F4N3O4S/c20-14-4-2-5-16(12-14)24-18(27)30-25-15-7-9-26(10-8-15)31(28,29)17-6-1-3-13(11-17)19(21,22)23/h1-6,11-12H,7-10H2,(H,24,27) |
| InChIKey | ZVKZNIDJDMJJNN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|