C17H22F3N3O5S — CID 25125239
N-(1-hydroxypropan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide (PubChem CID 25125239) has the molecular formula C17H22F3N3O5S and a molecular weight of 437.44 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 25125239 |
| Molecular Formula | C17H22F3N3O5S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide |
| SMILES | CC(CO)NC(=O)CON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H22F3N3O5S/c1-12(10-24)21-16(25)11-28-22-14-5-7-23(8-6-14)29(26,27)15-4-2-3-13(9-15)17(18,19)20/h2-4,9,12,24H,5-8,10-11H2,1H3,(H,21,25) |
| InChIKey | YGUNYAXYHOMGBD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|