C22H32F3N3O4S — CID 58378616
2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxy-N-(2,4,4-trimethylpentan-2-yl)acetamide (PubChem CID 58378616) has the molecular formula C22H32F3N3O4S and a molecular weight of 491.58 g/mol. Its IUPAC name is 2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxy-N-(2,4,4-trimethylpentan-2-yl)acetamide.
| Compound Name | 2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxy-N-(2,4,4-trimethylpentan-2-yl)acetamide |
|---|---|
| PubChem CID | 58378616 |
| Molecular Formula | C22H32F3N3O4S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxy-N-(2,4,4-trimethylpentan-2-yl)acetamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H32F3N3O4S/c1-20(2,3)15-21(4,5)26-19(29)14-32-27-17-9-11-28(12-10-17)33(30,31)18-8-6-7-16(13-18)22(23,24)25/h6-8,13H,9-12,14-15H2,1-5H3,(H,26,29) |
| InChIKey | ICWHEUDCAKSCCE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|