C21H30F3N3O4S — CID 25126905
N-(5-methylhexan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide (PubChem CID 25126905) has the molecular formula C21H30F3N3O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide.
| Compound Name | N-(5-methylhexan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 25126905 |
| Molecular Formula | C21H30F3N3O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-(5-methylhexan-2-yl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide |
| SMILES | CC(C)CCC(C)NC(=O)CON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H30F3N3O4S/c1-15(2)7-8-16(3)25-20(28)14-31-26-18-9-11-27(12-10-18)32(29,30)19-6-4-5-17(13-19)21(22,23)24/h4-6,13,15-16H,7-12,14H2,1-3H3,(H,25,28) |
| InChIKey | WRIXVLPHKBSQCR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|