C23H32F3N3O6S — CID 87662575
tert-butyl 3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxymethyl]piperidine-1-carboxylate (PubChem CID 87662575) has the molecular formula C23H32F3N3O6S and a molecular weight of 535.59 g/mol. Its IUPAC name is tert-butyl 3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87662575 |
| Molecular Formula | C23H32F3N3O6S |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | tert-butyl 3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CON=C2CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)C1 |
| InChI | InChI=1S/C23H32F3N3O6S/c1-22(2,3)35-21(30)28-12-4-5-17(15-28)16-33-27-18-10-13-29(14-11-18)36(31,32)20-8-6-19(7-9-20)34-23(24,25)26/h6-9,17H,4-5,10-16H2,1-3H3 |
| InChIKey | HWOUEGCUHWKYTR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|