C22H22F4N2O4S — CID 87661063
N-[(2-cyclopropyl-4-fluorophenyl)methoxy]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-imine (PubChem CID 87661063) has the molecular formula C22H22F4N2O4S and a molecular weight of 486.49 g/mol. Its IUPAC name is N-[(2-cyclopropyl-4-fluorophenyl)methoxy]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-imine.
| Compound Name | N-[(2-cyclopropyl-4-fluorophenyl)methoxy]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-imine |
|---|---|
| PubChem CID | 87661063 |
| Molecular Formula | C22H22F4N2O4S |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[(2-cyclopropyl-4-fluorophenyl)methoxy]-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-imine |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CCC(=NOCc2ccc(F)cc2C2CC2)CC1 |
| InChI | InChI=1S/C22H22F4N2O4S/c23-17-4-3-16(21(13-17)15-1-2-15)14-31-27-18-9-11-28(12-10-18)33(29,30)20-7-5-19(6-8-20)32-22(24,25)26/h3-8,13,15H,1-2,9-12,14H2 |
| InChIKey | DLIRXMAIHJBMMA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|