C20H17F4N3O3 — CID 90747651
[[1-[3-(trifluoromethyl)benzoyl]-3,6-dihydro-2H-pyridin-4-yl]amino] N-(4-fluorophenyl)carbamate (PubChem CID 90747651) has the molecular formula C20H17F4N3O3 and a molecular weight of 423.37 g/mol. Its IUPAC name is [[1-[3-(trifluoromethyl)benzoyl]-3,6-dihydro-2H-pyridin-4-yl]amino] N-(4-fluorophenyl)carbamate.
| Compound Name | [[1-[3-(trifluoromethyl)benzoyl]-3,6-dihydro-2H-pyridin-4-yl]amino] N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 90747651 |
| Molecular Formula | C20H17F4N3O3 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [[1-[3-(trifluoromethyl)benzoyl]-3,6-dihydro-2H-pyridin-4-yl]amino] N-(4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1)ONC1=CCN(C(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H17F4N3O3/c21-15-4-6-16(7-5-15)25-19(29)30-26-17-8-10-27(11-9-17)18(28)13-2-1-3-14(12-13)20(22,23)24/h1-8,12,26H,9-11H2,(H,25,29) |
| InChIKey | ZTJYGSSGBIQSQZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|