C21H19F4N3O3 — CID 87367729
[[1-[2-[3-(trifluoromethyl)phenyl]acetyl]piperidin-4-ylidene]amino] N-(4-fluorophenyl)carbamate (PubChem CID 87367729) has the molecular formula C21H19F4N3O3 and a molecular weight of 437.39 g/mol. Its IUPAC name is [[1-[2-[3-(trifluoromethyl)phenyl]acetyl]piperidin-4-ylidene]amino] N-(4-fluorophenyl)carbamate.
| Compound Name | [[1-[2-[3-(trifluoromethyl)phenyl]acetyl]piperidin-4-ylidene]amino] N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 87367729 |
| Molecular Formula | C21H19F4N3O3 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [[1-[2-[3-(trifluoromethyl)phenyl]acetyl]piperidin-4-ylidene]amino] N-(4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1)ON=C1CCN(C(=O)Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H19F4N3O3/c22-16-4-6-17(7-5-16)26-20(30)31-27-18-8-10-28(11-9-18)19(29)13-14-2-1-3-15(12-14)21(23,24)25/h1-7,12H,8-11,13H2,(H,26,30) |
| InChIKey | CXIVWFQOTUNWCQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|