C27H23F4N3O3 — CID 91369783
3-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(2,4-difluorophenyl)-3-oxopropanamide (PubChem CID 91369783) has the molecular formula C27H23F4N3O3 and a molecular weight of 513.49 g/mol. Its IUPAC name is 3-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(2,4-difluorophenyl)-3-oxopropanamide.
| Compound Name | 3-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(2,4-difluorophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 91369783 |
| Molecular Formula | C27H23F4N3O3 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 3-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(2,4-difluorophenyl)-3-oxopropanamide |
| SMILES | O=C(CC(=O)N1CC=C(NOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C27H23F4N3O3/c28-19-5-1-17(2-6-19)27(18-3-7-20(29)8-4-18)37-33-22-11-13-34(14-12-22)26(36)16-25(35)32-24-10-9-21(30)15-23(24)31/h1-11,15,27,33H,12-14,16H2,(H,32,35) |
| InChIKey | NFTVWCBCPBKNCU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|