C26H22F3N3O — CID 91568399
5-[[[1-[bis(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile (PubChem CID 91568399) has the molecular formula C26H22F3N3O and a molecular weight of 449.48 g/mol. Its IUPAC name is 5-[[[1-[bis(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[[1-[bis(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 91568399 |
| Molecular Formula | C26H22F3N3O |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 5-[[[1-[bis(4-fluorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CONC2=CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C26H22F3N3O/c27-22-6-2-19(3-7-22)26(20-4-8-23(28)9-5-20)32-13-11-24(12-14-32)31-33-17-18-1-10-25(29)21(15-18)16-30/h1-11,15,26,31H,12-14,17H2 |
| InChIKey | KPDFQHNTMXIGHK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|