C27H26N4O2 — CID 91226995
N-benzhydryl-4-[(3-cyanophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 91226995) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-benzhydryl-4-[(3-cyanophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-benzhydryl-4-[(3-cyanophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 91226995 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-benzhydryl-4-[(3-cyanophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | N#Cc1cccc(CONC2=CCN(C(=O)NC(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H26N4O2/c28-19-21-8-7-9-22(18-21)20-33-30-25-14-16-31(17-15-25)27(32)29-26(23-10-3-1-4-11-23)24-12-5-2-6-13-24/h1-14,18,26,30H,15-17,20H2,(H,29,32) |
| InChIKey | BGTSUUXYIDNETR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|