C28H22F3N3O2 — CID 91320530
5-[[[1-[3,3-bis(4-fluorophenyl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile (PubChem CID 91320530) has the molecular formula C28H22F3N3O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 5-[[[1-[3,3-bis(4-fluorophenyl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[[1-[3,3-bis(4-fluorophenyl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 91320530 |
| Molecular Formula | C28H22F3N3O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 5-[[[1-[3,3-bis(4-fluorophenyl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CONC2=CCN(C(=O)C=C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C28H22F3N3O2/c29-23-6-2-20(3-7-23)26(21-4-8-24(30)9-5-21)16-28(35)34-13-11-25(12-14-34)33-36-18-19-1-10-27(31)22(15-19)17-32/h1-11,15-16,33H,12-14,18H2 |
| InChIKey | OPQWYCFPICXKRH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|