C22H21F2N3O2 — CID 91279754
2-fluoro-5-[[[1-[3-(4-fluorophenyl)propanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile (PubChem CID 91279754) has the molecular formula C22H21F2N3O2 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-fluoro-5-[[[1-[3-(4-fluorophenyl)propanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[[1-[3-(4-fluorophenyl)propanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 91279754 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-fluoro-5-[[[1-[3-(4-fluorophenyl)propanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]benzonitrile |
| SMILES | N#Cc1cc(CONC2=CCN(C(=O)CCc3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C22H21F2N3O2/c23-19-5-1-16(2-6-19)4-8-22(28)27-11-9-20(10-12-27)26-29-15-17-3-7-21(24)18(13-17)14-25/h1-3,5-7,9,13,26H,4,8,10-12,15H2 |
| InChIKey | QJGSELYMJZNMEN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|