C20H19F3N2O2 — CID 91137670
phenyl-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 91137670) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is phenyl-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | phenyl-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 91137670 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | phenyl-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H19F3N2O2/c21-20(22,23)17-8-4-5-15(13-17)14-27-24-18-9-11-25(12-10-18)19(26)16-6-2-1-3-7-16/h1-9,13,24H,10-12,14H2 |
| InChIKey | NWOPTLNXZRCECY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|