C28H34F3N3O2 — CID 91031036
3-(4-benzylpiperidin-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propan-1-one (PubChem CID 91031036) has the molecular formula C28H34F3N3O2 and a molecular weight of 501.59 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propan-1-one.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 91031036 |
| Molecular Formula | C28H34F3N3O2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CCC(Cc2ccccc2)CC1)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C28H34F3N3O2/c29-28(30,31)25-8-4-7-24(20-25)21-36-32-26-11-17-34(18-12-26)27(35)13-16-33-14-9-23(10-15-33)19-22-5-2-1-3-6-22/h1-8,11,20,23,32H,9-10,12-19,21H2 |
| InChIKey | XUGOCQIYULAFBA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|