C28H28F2N2O2 — CID 91273862
4,4-bis(4-fluorophenyl)-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one (PubChem CID 91273862) has the molecular formula C28H28F2N2O2 and a molecular weight of 462.54 g/mol. Its IUPAC name is 4,4-bis(4-fluorophenyl)-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one.
| Compound Name | 4,4-bis(4-fluorophenyl)-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 91273862 |
| Molecular Formula | C28H28F2N2O2 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4,4-bis(4-fluorophenyl)-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
| SMILES | O=C(CCC(c1ccc(F)cc1)c1ccc(F)cc1)N1CC=C(NOCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H28F2N2O2/c29-24-10-6-22(7-11-24)27(23-8-12-25(30)13-9-23)14-15-28(33)32-18-16-26(17-19-32)31-34-20-21-4-2-1-3-5-21/h1-13,16,27,31H,14-15,17-20H2 |
| InChIKey | CXRJOHDMSYBOBJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|