C26H23ClF3N3O — CID 87660797
5-[[[1-[bis(4-fluorophenyl)methyl]piperidin-4-ylidene]amino]oxymethyl]-2-fluorobenzonitrile;hydrochloride (PubChem CID 87660797) has the molecular formula C26H23ClF3N3O and a molecular weight of 485.94 g/mol. Its IUPAC name is 5-[[[1-[bis(4-fluorophenyl)methyl]piperidin-4-ylidene]amino]oxymethyl]-2-fluorobenzonitrile;hydrochloride.
| Compound Name | 5-[[[1-[bis(4-fluorophenyl)methyl]piperidin-4-ylidene]amino]oxymethyl]-2-fluorobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 87660797 |
| Molecular Formula | C26H23ClF3N3O |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 5-[[[1-[bis(4-fluorophenyl)methyl]piperidin-4-ylidene]amino]oxymethyl]-2-fluorobenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc(CON=C2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C26H22F3N3O.ClH/c27-22-6-2-19(3-7-22)26(20-4-8-23(28)9-5-20)32-13-11-24(12-14-32)31-33-17-18-1-10-25(29)21(15-18)16-30;/h1-10,15,26H,11-14,17H2;1H |
| InChIKey | YJAKMFVYYVSHBQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|