C23H18F3NO3 — CID 91084397
methyl 2-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetate (PubChem CID 91084397) has the molecular formula C23H18F3NO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is methyl 2-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 91084397 |
| Molecular Formula | C23H18F3NO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 2-[3-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H18F3NO3/c1-30-21(28)14-15-5-4-6-18(13-15)27-22(29)20-8-3-2-7-19(20)16-9-11-17(12-10-16)23(24,25)26/h2-13H,14H2,1H3,(H,27,29) |
| InChIKey | RGSODVURJWQWPQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |