C23H17F5N2O — CID 91084640
3-(5-fluoro-2-methoxyphenyl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4H-cinnoline (PubChem CID 91084640) has the molecular formula C23H17F5N2O and a molecular weight of 432.39 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxyphenyl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4H-cinnoline.
| Compound Name | 3-(5-fluoro-2-methoxyphenyl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4H-cinnoline |
|---|---|
| PubChem CID | 91084640 |
| Molecular Formula | C23H17F5N2O |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-(5-fluoro-2-methoxyphenyl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-4H-cinnoline |
| SMILES | COc1ccc(F)cc1C1=NN(Cc2ccc(C(F)(F)F)cc2F)c2ccccc2C1 |
| InChI | InChI=1S/C23H17F5N2O/c1-31-22-9-8-17(24)12-18(22)20-10-14-4-2-3-5-21(14)30(29-20)13-15-6-7-16(11-19(15)25)23(26,27)28/h2-9,11-12H,10,13H2,1H3 |
| InChIKey | BZLZVOACSYOLKS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |