C16H23ClN2OS — CID 91086039
N-[(3-chloro-2-methylphenyl)methyl]-2-(2-methylpropyl)-1,2-thiazolidine-3-carboxamide (PubChem CID 91086039) has the molecular formula C16H23ClN2OS and a molecular weight of 326.89 g/mol. Its IUPAC name is N-[(3-chloro-2-methylphenyl)methyl]-2-(2-methylpropyl)-1,2-thiazolidine-3-carboxamide.
| Compound Name | N-[(3-chloro-2-methylphenyl)methyl]-2-(2-methylpropyl)-1,2-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 91086039 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[(3-chloro-2-methylphenyl)methyl]-2-(2-methylpropyl)-1,2-thiazolidine-3-carboxamide |
| SMILES | Cc1c(Cl)cccc1CNC(=O)C1CCSN1CC(C)C |
| InChI | InChI=1S/C16H23ClN2OS/c1-11(2)10-19-15(7-8-21-19)16(20)18-9-13-5-4-6-14(17)12(13)3/h4-6,11,15H,7-10H2,1-3H3,(H,18,20) |
| InChIKey | MPSSLIWRJPORHH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|