C17H30O2Si — CID 91087259
[[1-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutyl]-diethylsilyl]formic acid (PubChem CID 91087259) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is [[1-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutyl]-diethylsilyl]formic acid.
| Compound Name | [[1-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutyl]-diethylsilyl]formic acid |
|---|---|
| PubChem CID | 91087259 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | [[1-(2-bicyclo[2.2.1]hept-5-enyl)-2-methylbutyl]-diethylsilyl]formic acid |
| SMILES | CCC(C)C(C1CC2C=CC1C2)[Si](CC)(CC)C(=O)O |
| InChI | InChI=1S/C17H30O2Si/c1-5-12(4)16(20(6-2,7-3)17(18)19)15-11-13-8-9-14(15)10-13/h8-9,12-16H,5-7,10-11H2,1-4H3,(H,18,19) |
| InChIKey | WCEYDQYIVXYHBP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|