C14H11F6NO4 — CID 91087449
methyl 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 91087449) has the molecular formula C14H11F6NO4 and a molecular weight of 371.23 g/mol. Its IUPAC name is methyl 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 91087449 |
| Molecular Formula | C14H11F6NO4 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | methyl 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1C=C(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)NO1 |
| InChI | InChI=1S/C14H11F6NO4/c1-24-11(22)10-6-9(21-25-10)7-2-4-8(5-3-7)12(23,13(15,16)17)14(18,19)20/h2-6,10,21,23H,1H3 |
| InChIKey | LIPNTSQNONFHOU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |