C13H9F6NO4 — CID 91611398
3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-4-carboxylic acid (PubChem CID 91611398) has the molecular formula C13H9F6NO4 and a molecular weight of 357.21 g/mol. Its IUPAC name is 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 91611398 |
| Molecular Formula | C13H9F6NO4 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,5-dihydro-1,2-oxazole-4-carboxylic acid |
| SMILES | O=C(O)C1=C(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)NOC1 |
| InChI | InChI=1S/C13H9F6NO4/c14-12(15,16)11(23,13(17,18)19)7-3-1-6(2-4-7)9-8(10(21)22)5-24-20-9/h1-4,20,23H,5H2,(H,21,22) |
| InChIKey | ALXKOFMBUQNMGX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |