C18H22O10 — CID 91088653
tetramethyl (4R)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 91088653) has the molecular formula C18H22O10 and a molecular weight of 398.36 g/mol. Its IUPAC name is tetramethyl (4R)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetramethyl (4R)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 91088653 |
| Molecular Formula | C18H22O10 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | tetramethyl (4R)-3a,6a-dimethyl-2,5-dioxo-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)C2(C)[C@@H](C(=O)OC)C(=O)C(C(=O)OC)C12C |
| InChI | InChI=1S/C18H22O10/c1-17-7(13(21)25-3)11(19)9(15(23)27-5)18(17,2)10(16(24)28-6)12(20)8(17)14(22)26-4/h7-10H,1-6H3/t7-,8?,9?,10?,17?,18?/m1/s1 |
| InChIKey | HRMSHTCEPBXNME-NPXQDAHZSA-N |
| XLogP | -0.68 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|