C18H30ClN5O2 — CID 91089978
tert-butyl N-[[4-[[[N-(1-aminoprop-2-ynylidene)-N'-(chloromethyl)carbamimidoyl]amino]methyl]cyclohexyl]methyl]carbamate (PubChem CID 91089978) has the molecular formula C18H30ClN5O2 and a molecular weight of 383.92 g/mol. Its IUPAC name is tert-butyl N-[[4-[[[N-(1-aminoprop-2-ynylidene)-N'-(chloromethyl)carbamimidoyl]amino]methyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[[N-(1-aminoprop-2-ynylidene)-N'-(chloromethyl)carbamimidoyl]amino]methyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 91089978 |
| Molecular Formula | C18H30ClN5O2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl N-[[4-[[[N-(1-aminoprop-2-ynylidene)-N'-(chloromethyl)carbamimidoyl]amino]methyl]cyclohexyl]methyl]carbamate |
| SMILES | C#CC(N)=NC(=NCCl)NCC1CCC(CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30ClN5O2/c1-5-15(20)24-16(23-12-19)21-10-13-6-8-14(9-7-13)11-22-17(25)26-18(2,3)4/h1,13-14H,6-12H2,2-4H3,(H,22,25)(H3,20,21,23,24) |
| InChIKey | XFENZBQORAUHNK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|