C12H25N3O — CID 91091090
1,6-diamino-7-methyl-3-[2-(methylamino)ethyl]oct-7-en-4-one (PubChem CID 91091090) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 1,6-diamino-7-methyl-3-[2-(methylamino)ethyl]oct-7-en-4-one.
| Compound Name | 1,6-diamino-7-methyl-3-[2-(methylamino)ethyl]oct-7-en-4-one |
|---|---|
| PubChem CID | 91091090 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 1,6-diamino-7-methyl-3-[2-(methylamino)ethyl]oct-7-en-4-one |
| SMILES | C=C(C)C(N)CC(=O)C(CCN)CCNC |
| InChI | InChI=1S/C12H25N3O/c1-9(2)11(14)8-12(16)10(4-6-13)5-7-15-3/h10-11,15H,1,4-8,13-14H2,2-3H3 |
| InChIKey | VHIPZZJABKLWPP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|