C24H27FN4O3 — CID 91091812
7-[3a-(2-cyanoethylamino)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 91091812) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is 7-[3a-(2-cyanoethylamino)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[3a-(2-cyanoethylamino)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 91091812 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 7-[3a-(2-cyanoethylamino)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1c(N2CC3CCCC3(NCCC#N)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C24H27FN4O3/c1-14-20-17(22(30)18(23(31)32)12-29(20)16-5-6-16)10-19(25)21(14)28-11-15-4-2-7-24(15,13-28)27-9-3-8-26/h10,12,15-16,27H,2-7,9,11,13H2,1H3,(H,31,32) |
| InChIKey | FYQSOWPOMMBEMI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|