C17H13ClF3N5O2 — CID 91092268
N-[2-chloro-4-(trifluoromethyl)phenyl]-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)carbamoyl]formamide (PubChem CID 91092268) has the molecular formula C17H13ClF3N5O2 and a molecular weight of 411.77 g/mol. Its IUPAC name is N-[2-chloro-4-(trifluoromethyl)phenyl]-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)carbamoyl]formamide.
| Compound Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)carbamoyl]formamide |
|---|---|
| PubChem CID | 91092268 |
| Molecular Formula | C17H13ClF3N5O2 |
| Molecular Weight | 411.77 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)carbamoyl]formamide |
| SMILES | Cc1nn(C)c2ncc(NC(=O)N(C=O)c3ccc(C(F)(F)F)cc3Cl)cc12 |
| InChI | InChI=1S/C17H13ClF3N5O2/c1-9-12-6-11(7-22-15(12)25(2)24-9)23-16(28)26(8-27)14-4-3-10(5-13(14)18)17(19,20)21/h3-8H,1-2H3,(H,23,28) |
| InChIKey | ZAAOCILKPZNXQP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|