C34H42F3N3O2 — CID 91094158
N-but-3-enyl-4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-methylpropyl]benzamide (PubChem CID 91094158) has the molecular formula C34H42F3N3O2 and a molecular weight of 581.72 g/mol. Its IUPAC name is N-but-3-enyl-4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-methylpropyl]benzamide.
| Compound Name | N-but-3-enyl-4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 91094158 |
| Molecular Formula | C34H42F3N3O2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | N-but-3-enyl-4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]-2-methylpropyl]benzamide |
| SMILES | C=CCCNC(=O)c1ccc(C(C(C)C)N2C(=O)C(c3cccc(C(F)(F)F)c3)=NC23CCC(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C34H42F3N3O2/c1-7-8-20-38-30(41)24-14-12-23(13-15-24)29(22(2)3)40-31(42)28(25-10-9-11-27(21-25)34(35,36)37)39-33(40)18-16-26(17-19-33)32(4,5)6/h7,9-15,21-22,26,29H,1,8,16-20H2,2-6H3,(H,38,41) |
| InChIKey | DNOGWPXWFGAVRE-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|