C35H43F3N2O4 — CID 91349684
8-[4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]phenyl]-8-oxooctanoic acid (PubChem CID 91349684) has the molecular formula C35H43F3N2O4 and a molecular weight of 612.73 g/mol. Its IUPAC name is 8-[4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]phenyl]-8-oxooctanoic acid.
| Compound Name | 8-[4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]phenyl]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 91349684 |
| Molecular Formula | C35H43F3N2O4 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | 8-[4-[1-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]phenyl]-8-oxooctanoic acid |
| SMILES | CC(c1ccc(C(=O)CCCCCCC(=O)O)cc1)N1C(=O)C(c2cccc(C(F)(F)F)c2)=NC12CCC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C35H43F3N2O4/c1-23(24-14-16-25(17-15-24)29(41)12-7-5-6-8-13-30(42)43)40-32(44)31(26-10-9-11-28(22-26)35(36,37)38)39-34(40)20-18-27(19-21-34)33(2,3)4/h9-11,14-17,22-23,27H,5-8,12-13,18-21H2,1-4H3,(H,42,43) |
| InChIKey | XGOYSJIYDOHOES-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|