C13H23NO2S — CID 91095574
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-tert-butylmethanesulfonamide (PubChem CID 91095574) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-tert-butylmethanesulfonamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-tert-butylmethanesulfonamide |
|---|---|
| PubChem CID | 91095574 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-N-tert-butylmethanesulfonamide |
| SMILES | CC(C)(C)N(CC1CC2C=CC1C2)S(C)(=O)=O |
| InChI | InChI=1S/C13H23NO2S/c1-13(2,3)14(17(4,15)16)9-12-8-10-5-6-11(12)7-10/h5-6,10-12H,7-9H2,1-4H3 |
| InChIKey | YGXVDLIMSXVMPB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|