C13H24NO3S+ — CID 122593529
[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 122593529) has the molecular formula C13H24NO3S+ and a molecular weight of 274.41 g/mol. Its IUPAC name is [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 122593529 |
| Molecular Formula | C13H24NO3S+ |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCS(=O)(=O)O)CC1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H23NO3S/c1-14(2,6-3-7-18(15,16)17)10-13-9-11-4-5-12(13)8-11/h4-5,11-13H,3,6-10H2,1-2H3/p+1/t11-,12+,13?/m1/s1 |
| InChIKey | KJWSFCOHEAQNHZ-OJRHAOMCSA-O |
| XLogP | 1.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|