C12H12O3 — CID 91096607
6-[(2-hydroxyphenyl)methylidene]oxan-2-one (PubChem CID 91096607) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-[(2-hydroxyphenyl)methylidene]oxan-2-one.
| Compound Name | 6-[(2-hydroxyphenyl)methylidene]oxan-2-one |
|---|---|
| PubChem CID | 91096607 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 6-[(2-hydroxyphenyl)methylidene]oxan-2-one |
| SMILES | O=C1CCCC(=Cc2ccccc2O)O1 |
| InChI | InChI=1S/C12H12O3/c13-11-6-2-1-4-9(11)8-10-5-3-7-12(14)15-10/h1-2,4,6,8,13H,3,5,7H2 |
| InChIKey | FOYLPBUIQUPKSV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |