C14H24N6O2S — CID 91096692
tert-butyl 3-[(dimethylaminomethylideneamino)-sulfanylmethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate (PubChem CID 91096692) has the molecular formula C14H24N6O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is tert-butyl 3-[(dimethylaminomethylideneamino)-sulfanylmethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 3-[(dimethylaminomethylideneamino)-sulfanylmethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 91096692 |
| Molecular Formula | C14H24N6O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | tert-butyl 3-[(dimethylaminomethylideneamino)-sulfanylmethyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
| SMILES | CN(C)C=NC(S)c1nnc2n1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C14H24N6O2S/c1-14(2,3)22-13(21)19-6-7-20-10(8-19)16-17-11(20)12(23)15-9-18(4)5/h9,12,23H,6-8H2,1-5H3 |
| InChIKey | IOPLJEZUHSWCEM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|