C19H35F2NO — CID 91097016
2-butan-2-yl-8-(2,2-difluoropentoxy)-3,9-dimethyl-2,3,4,5,6,9-hexahydro-1H-azonine (PubChem CID 91097016) has the molecular formula C19H35F2NO and a molecular weight of 331.49 g/mol. Its IUPAC name is 2-butan-2-yl-8-(2,2-difluoropentoxy)-3,9-dimethyl-2,3,4,5,6,9-hexahydro-1H-azonine.
| Compound Name | 2-butan-2-yl-8-(2,2-difluoropentoxy)-3,9-dimethyl-2,3,4,5,6,9-hexahydro-1H-azonine |
|---|---|
| PubChem CID | 91097016 |
| Molecular Formula | C19H35F2NO |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 2-butan-2-yl-8-(2,2-difluoropentoxy)-3,9-dimethyl-2,3,4,5,6,9-hexahydro-1H-azonine |
| SMILES | CCCC(F)(F)COC1=CCCCC(C)C(C(C)CC)NC1C |
| InChI | InChI=1S/C19H35F2NO/c1-6-12-19(20,21)13-23-17-11-9-8-10-15(4)18(14(3)7-2)22-16(17)5/h11,14-16,18,22H,6-10,12-13H2,1-5H3 |
| InChIKey | IIRNJLBHWVURNU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |