C14H16N4 — CID 91097264
3-(2,5-diaminophenyl)-2-methyl-2-(1H-pyrrol-2-yl)propanenitrile (PubChem CID 91097264) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-(2,5-diaminophenyl)-2-methyl-2-(1H-pyrrol-2-yl)propanenitrile.
| Compound Name | 3-(2,5-diaminophenyl)-2-methyl-2-(1H-pyrrol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 91097264 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-(2,5-diaminophenyl)-2-methyl-2-(1H-pyrrol-2-yl)propanenitrile |
| SMILES | CC(C#N)(Cc1cc(N)ccc1N)c1ccc[nH]1 |
| InChI | InChI=1S/C14H16N4/c1-14(9-15,13-3-2-6-18-13)8-10-7-11(16)4-5-12(10)17/h2-7,18H,8,16-17H2,1H3 |
| InChIKey | KYGSVTIQQGUZMS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|