C18H13BrF2N2O2 — CID 91097597
6-[bromo(difluoro)methoxy]-2-(1-methylindol-5-yl)isoindol-1-ol (PubChem CID 91097597) has the molecular formula C18H13BrF2N2O2 and a molecular weight of 407.21 g/mol. Its IUPAC name is 6-[bromo(difluoro)methoxy]-2-(1-methylindol-5-yl)isoindol-1-ol.
| Compound Name | 6-[bromo(difluoro)methoxy]-2-(1-methylindol-5-yl)isoindol-1-ol |
|---|---|
| PubChem CID | 91097597 |
| Molecular Formula | C18H13BrF2N2O2 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 6-[bromo(difluoro)methoxy]-2-(1-methylindol-5-yl)isoindol-1-ol |
| SMILES | Cn1ccc2cc(-n3cc4ccc(OC(F)(F)Br)cc4c3O)ccc21 |
| InChI | InChI=1S/C18H13BrF2N2O2/c1-22-7-6-11-8-13(3-5-16(11)22)23-10-12-2-4-14(25-18(19,20)21)9-15(12)17(23)24/h2-10,24H,1H3 |
| InChIKey | UKEQVBRJSWVSNW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 39.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|