C25H22F4N2O3 — CID 91098687
prop-1-en-2-yl N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-methoxy-2-pyridinyl)-2-phenylethyl]carbamate (PubChem CID 91098687) has the molecular formula C25H22F4N2O3 and a molecular weight of 474.45 g/mol. Its IUPAC name is prop-1-en-2-yl N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-methoxy-2-pyridinyl)-2-phenylethyl]carbamate.
| Compound Name | prop-1-en-2-yl N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-methoxy-2-pyridinyl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 91098687 |
| Molecular Formula | C25H22F4N2O3 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | prop-1-en-2-yl N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1-(5-methoxy-2-pyridinyl)-2-phenylethyl]carbamate |
| SMILES | C=C(C)OC(=O)NC(c1ccc(OC)cn1)C(c1ccccc1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F4N2O3/c1-15(2)34-24(32)31-23(21-10-9-20(33-3)14-30-21)22(16-7-5-4-6-8-16)17-11-18(25(27,28)29)13-19(26)12-17/h4-14,22-23H,1H2,2-3H3,(H,31,32) |
| InChIKey | FBLYRJWNSLSGDN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|