C17H17NO5S — CID 91098856
2,7-dimethyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3,6-dicarboxylic acid (PubChem CID 91098856) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 2,7-dimethyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3,6-dicarboxylic acid.
| Compound Name | 2,7-dimethyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91098856 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2,7-dimethyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3,6-dicarboxylic acid |
| SMILES | CC1=NC2=C(C(=O)C(C(=O)O)C(C)C2)C(c2cccs2)C1C(=O)O |
| InChI | InChI=1S/C17H17NO5S/c1-7-6-9-13(15(19)11(7)16(20)21)14(10-4-3-5-24-10)12(17(22)23)8(2)18-9/h3-5,7,11-12,14H,6H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | PSSUQGAHYKFNMV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|