C11H14O4 — CID 91099063
5-methoxy-6-oxo-3-prop-1-enylcyclohexene-1-carboxylic acid (PubChem CID 91099063) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-methoxy-6-oxo-3-prop-1-enylcyclohexene-1-carboxylic acid.
| Compound Name | 5-methoxy-6-oxo-3-prop-1-enylcyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 91099063 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 5-methoxy-6-oxo-3-prop-1-enylcyclohexene-1-carboxylic acid |
| SMILES | CC=CC1C=C(C(=O)O)C(=O)C(OC)C1 |
| InChI | InChI=1S/C11H14O4/c1-3-4-7-5-8(11(13)14)10(12)9(6-7)15-2/h3-5,7,9H,6H2,1-2H3,(H,13,14) |
| InChIKey | JZSXVJHDQWRTAT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|