About N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine
N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine (PubChem CID 91099667) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine.
Molecular Properties
| Compound Name | N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine |
| PubChem CID | 91099667 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine |
| SMILES | CCCN(C(C)CC(C)(C)CC)C1CC1 |
| InChI | InChI=1S/C14H29N/c1-6-10-15(13-8-9-13)12(3)11-14(4,5)7-2/h12-13H,6-11H2,1-5H3 |
| InChIKey | RRBPNWOAORCZLS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine?
The IUPAC name of N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine (CID 91099667) is N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine.
What is the SMILES notation for N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine?
The canonical SMILES for N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine is CCCN(C(C)CC(C)(C)CC)C1CC1.
What is the InChIKey of N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine?
The InChIKey is RRBPNWOAORCZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N/c1-6-10-15(13-8-9-13)12(3)11-14(4,5)7-2/h12-13H,6-11H2,1-5H3.
What are the key properties of N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine?
N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine has a molecular weight of 211.39 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylhexan-2-yl)-N-propylcyclopropanamine is sourced from PubChem (CID 91099667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).