C26H24O — CID 91099831
2-(1-methoxy-4,4a-dihydronaphthalen-2-yl)-9,9-dimethylfluorene (PubChem CID 91099831) has the molecular formula C26H24O and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-(1-methoxy-4,4a-dihydronaphthalen-2-yl)-9,9-dimethylfluorene.
| Compound Name | 2-(1-methoxy-4,4a-dihydronaphthalen-2-yl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 91099831 |
| Molecular Formula | C26H24O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-(1-methoxy-4,4a-dihydronaphthalen-2-yl)-9,9-dimethylfluorene |
| SMILES | COC1=C2C=CC=CC2CC=C1c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C26H24O/c1-26(2)23-11-7-6-10-21(23)22-15-13-18(16-24(22)26)20-14-12-17-8-4-5-9-19(17)25(20)27-3/h4-11,13-17H,12H2,1-3H3 |
| InChIKey | AYGLFYWFJDBWOX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |