C34H46O18 — CID 91100198
bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] 2-butan-2-yl-2,3-dihydroxybutanedioate (PubChem CID 91100198) has the molecular formula C34H46O18 and a molecular weight of 742.72 g/mol. Its IUPAC name is bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] 2-butan-2-yl-2,3-dihydroxybutanedioate.
| Compound Name | bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] 2-butan-2-yl-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 91100198 |
| Molecular Formula | C34H46O18 |
| Molecular Weight | 742.72 g/mol |
| Exact Mass | 742.27 |
| IUPAC Name | bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] 2-butan-2-yl-2,3-dihydroxybutanedioate |
| SMILES | CCC(C)C(O)(C(=O)OCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)C(O)C(=O)OCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)C2O)cc1 |
| InChI | InChI=1S/C34H46O18/c1-3-16(2)34(46,33(45)48-15-18-6-10-20(11-7-18)50-32-28(42)26(40)24(38)22(13-36)52-32)29(43)30(44)47-14-17-4-8-19(9-5-17)49-31-27(41)25(39)23(37)21(12-35)51-31/h4-11,16,21-29,31-32,35-43,46H,3,12-15H2,1-2H3/t16?,21-,22-,23-,24-,25+,26+,27?,28-,29?,31-,32-,34?/m1/s1 |
| InChIKey | RALONRKWUJSZDW-CNCNZLRTSA-N |
| XLogP | -3.03 |
| TPSA | 291.82 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.72 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |