C24H30O11 — CID 124905231
[4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2S,3S)-2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanoate (PubChem CID 124905231) has the molecular formula C24H30O11 and a molecular weight of 494.49 g/mol. Its IUPAC name is [4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2S,3S)-2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanoate.
| Compound Name | [4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2S,3S)-2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 124905231 |
| Molecular Formula | C24H30O11 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl (2S,3S)-2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanoate |
| SMILES | C[C@H](O)[C@@](O)(Cc1ccc(O)cc1)C(=O)OCc1ccc(O[C@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C24H30O11/c1-13(26)24(32,10-14-2-6-16(27)7-3-14)23(31)33-12-15-4-8-17(9-5-15)34-22-21(30)20(29)19(28)18(11-25)35-22/h2-9,13,18-22,25-30,32H,10-12H2,1H3/t13-,18-,19-,20+,21-,22-,24-/m0/s1 |
| InChIKey | FKMASXTUONWHBB-CFAMDGMWSA-N |
| XLogP | -1.03 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |