C24H22F3N3O — CID 91100499
2-[3-[1-(1-pyridin-3-ylpiperidin-4-ylidene)ethyl]phenoxy]-5-(trifluoromethyl)pyridine (PubChem CID 91100499) has the molecular formula C24H22F3N3O and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-[3-[1-(1-pyridin-3-ylpiperidin-4-ylidene)ethyl]phenoxy]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[3-[1-(1-pyridin-3-ylpiperidin-4-ylidene)ethyl]phenoxy]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 91100499 |
| Molecular Formula | C24H22F3N3O |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-[3-[1-(1-pyridin-3-ylpiperidin-4-ylidene)ethyl]phenoxy]-5-(trifluoromethyl)pyridine |
| SMILES | CC(=C1CCN(c2cccnc2)CC1)c1cccc(Oc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C24H22F3N3O/c1-17(18-9-12-30(13-10-18)21-5-3-11-28-16-21)19-4-2-6-22(14-19)31-23-8-7-20(15-29-23)24(25,26)27/h2-8,11,14-16H,9-10,12-13H2,1H3 |
| InChIKey | TWSSFQPPBBUSCH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |