C13H16N+ — CID 91101440
7-methyl-8-(3-methylbut-3-enyl)-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene (PubChem CID 91101440) has the molecular formula C13H16N+ and a molecular weight of 186.28 g/mol. Its IUPAC name is 7-methyl-8-(3-methylbut-3-enyl)-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene.
| Compound Name | 7-methyl-8-(3-methylbut-3-enyl)-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene |
|---|---|
| PubChem CID | 91101440 |
| Molecular Formula | C13H16N+ |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 7-methyl-8-(3-methylbut-3-enyl)-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraene |
| SMILES | C=C(C)CCC1=c2ccccc2=[N+]1C |
| InChI | InChI=1S/C13H16N/c1-10(2)8-9-13-11-6-4-5-7-12(11)14(13)3/h4-7H,1,8-9H2,2-3H3/q+1 |
| InChIKey | VSPMHEILLHKWHA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|