C6H6N4O — CID 91101879
2,8-dihydro-1H-pteridin-7-one (PubChem CID 91101879) has the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. Its IUPAC name is 2,8-dihydro-1H-pteridin-7-one.
| Compound Name | 2,8-dihydro-1H-pteridin-7-one |
|---|---|
| PubChem CID | 91101879 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2,8-dihydro-1H-pteridin-7-one |
| SMILES | O=c1cnc2c([nH]1)NCN=C2 |
| InChI | InChI=1S/C6H6N4O/c11-5-2-8-4-1-7-3-9-6(4)10-5/h1-2H,3H2,(H2,9,10,11) |
| InChIKey | YQBOBCIESHXDHF-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |